C15H18FN3 — CID 107931759
3-[ethylamino-(2-fluoro-5-methylphenyl)methyl]pyridin-2-amine (PubChem CID 107931759) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-[ethylamino-(2-fluoro-5-methylphenyl)methyl]pyridin-2-amine.
| Compound Name | 3-[ethylamino-(2-fluoro-5-methylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 107931759 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-[ethylamino-(2-fluoro-5-methylphenyl)methyl]pyridin-2-amine |
| SMILES | CCNC(c1cc(C)ccc1F)c1cccnc1N |
| InChI | InChI=1S/C15H18FN3/c1-3-18-14(11-5-4-8-19-15(11)17)12-9-10(2)6-7-13(12)16/h4-9,14,18H,3H2,1-2H3,(H2,17,19) |
| InChIKey | BJHAOWKEZHZPNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |