About [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone (PubChem CID 1079321) has the molecular formula C19H19ClN2O3
and a molecular weight of 358.83 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone.
Molecular Properties
| Compound Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone |
| PubChem CID | 1079321 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H19ClN2O3/c20-16-3-1-2-15(11-16)19(23)22-8-6-21(7-9-22)12-14-4-5-17-18(10-14)25-13-24-17/h1-5,10-11H,6-9,12-13H2 |
| InChIKey | BBTFALYSPHVYCH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone?
The IUPAC name of [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone (CID 1079321) is [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone.
What is the SMILES notation for [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone?
The canonical SMILES for [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone is O=C(c1cccc(Cl)c1)N1CCN(Cc2ccc3c(c2)OCO3)CC1.
What is the InChIKey of [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone?
The InChIKey is BBTFALYSPHVYCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O3/c20-16-3-1-2-15(11-16)19(23)22-8-6-21(7-9-22)12-14-4-5-17-18(10-14)25-13-24-17/h1-5,10-11H,6-9,12-13H2.
What are the key properties of [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone?
[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone has a molecular weight of 358.83 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-(3-chlorophenyl)methanone is sourced from PubChem (CID 1079321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).