About [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine
[2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine (PubChem CID 107932981) has the molecular formula C13H15F5N2
and a molecular weight of 294.27 g/mol. Its IUPAC name is [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine.
Molecular Properties
| Compound Name | [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine |
| PubChem CID | 107932981 |
| Molecular Formula | C13H15F5N2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine |
| SMILES | NCc1ccc(N2CCC(C(F)(F)F)CC2)c(F)c1F |
| InChI | InChI=1S/C13H15F5N2/c14-11-8(7-19)1-2-10(12(11)15)20-5-3-9(4-6-20)13(16,17)18/h1-2,9H,3-7,19H2 |
| InChIKey | YMGOCNCJZXRYFH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine?
The IUPAC name of [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine (CID 107932981) is [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine.
What is the SMILES notation for [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine?
The canonical SMILES for [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine is NCc1ccc(N2CCC(C(F)(F)F)CC2)c(F)c1F.
What is the InChIKey of [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine?
The InChIKey is YMGOCNCJZXRYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F5N2/c14-11-8(7-19)1-2-10(12(11)15)20-5-3-9(4-6-20)13(16,17)18/h1-2,9H,3-7,19H2.
What are the key properties of [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine?
[2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine has a molecular weight of 294.27 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-difluoro-4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]methanamine is sourced from PubChem (CID 107932981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).