C24H23N5O5S — CID 1079334
N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 1079334) has the molecular formula C24H23N5O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 1079334 |
| Molecular Formula | C24H23N5O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C24H23N5O5S/c1-15-14-16(2)26-24(25-15)28-35(33,34)18-11-9-17(10-12-18)27-21(30)8-5-13-29-22(31)19-6-3-4-7-20(19)23(29)32/h3-4,6-7,9-12,14H,5,8,13H2,1-2H3,(H,27,30)(H,25,26,28) |
| InChIKey | GGQCOHHKPAZVPJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|