About 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile
4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile (PubChem CID 107933910) has the molecular formula C15H8F2N2S
and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile |
| PubChem CID | 107933910 |
| Molecular Formula | C15H8F2N2S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc3sccc3c2)c(F)c1F |
| InChI | InChI=1S/C15H8F2N2S/c16-14-10(8-18)1-3-12(15(14)17)19-11-2-4-13-9(7-11)5-6-20-13/h1-7,19H |
| InChIKey | JBBXEQJYRVUNIX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile?
The IUPAC name of 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile (CID 107933910) is 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile.
What is the SMILES notation for 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile?
The canonical SMILES for 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile is N#Cc1ccc(Nc2ccc3sccc3c2)c(F)c1F.
What is the InChIKey of 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile?
The InChIKey is JBBXEQJYRVUNIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F2N2S/c16-14-10(8-18)1-3-12(15(14)17)19-11-2-4-13-9(7-11)5-6-20-13/h1-7,19H.
What are the key properties of 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile?
4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile has a molecular weight of 286.31 g/mol, XLogP of 4.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzothiophen-5-ylamino)-2,3-difluorobenzonitrile is sourced from PubChem (CID 107933910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).