C30H59O7PSi — CID 10793547
[(E,2S,3S)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-yl] diethyl phosphate (PubChem CID 10793547) has the molecular formula C30H59O7PSi and a molecular weight of 590.86 g/mol. Its IUPAC name is [(E,2S,3S)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-yl] diethyl phosphate.
| Compound Name | [(E,2S,3S)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-yl] diethyl phosphate |
|---|---|
| PubChem CID | 10793547 |
| Molecular Formula | C30H59O7PSi |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | [(E,2S,3S)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-6-(methoxymethoxy)-6-methylhept-4-en-3-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O[C@@H](/C=C/C(C)(C)OCOC)[C@@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C30H59O7PSi/c1-13-34-38(31,35-14-2)36-26(19-21-29(7,8)33-22-32-10)23(3)24-17-18-25-27(16-15-20-30(24,25)9)37-39(11,12)28(4,5)6/h19,21,23-27H,13-18,20,22H2,1-12H3/b21-19+/t23-,24+,25-,26-,27-,30+/m0/s1 |
| InChIKey | AXFMHHXBTAHRFN-JNXDKFHGSA-N |
| XLogP | 8.75 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|