C9H8F3N5 — CID 107935487
2-[5-(2,3,4-trifluorophenyl)tetrazol-1-yl]ethanamine (PubChem CID 107935487) has the molecular formula C9H8F3N5 and a molecular weight of 243.19 g/mol. Its IUPAC name is 2-[5-(2,3,4-trifluorophenyl)tetrazol-1-yl]ethanamine.
| Compound Name | 2-[5-(2,3,4-trifluorophenyl)tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 107935487 |
| Molecular Formula | C9H8F3N5 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[5-(2,3,4-trifluorophenyl)tetrazol-1-yl]ethanamine |
| SMILES | NCCn1nnnc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H8F3N5/c10-6-2-1-5(7(11)8(6)12)9-14-15-16-17(9)4-3-13/h1-2H,3-4,13H2 |
| InChIKey | AHJBOOIWHCYMQZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|