C12H13FN2S — CID 107936736
5-(4-ethyl-1,3-thiazolidin-2-yl)-2-fluorobenzonitrile (PubChem CID 107936736) has the molecular formula C12H13FN2S and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-(4-ethyl-1,3-thiazolidin-2-yl)-2-fluorobenzonitrile.
| Compound Name | 5-(4-ethyl-1,3-thiazolidin-2-yl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107936736 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-(4-ethyl-1,3-thiazolidin-2-yl)-2-fluorobenzonitrile |
| SMILES | CCC1CSC(c2ccc(F)c(C#N)c2)N1 |
| InChI | InChI=1S/C12H13FN2S/c1-2-10-7-16-12(15-10)8-3-4-11(13)9(5-8)6-14/h3-5,10,12,15H,2,7H2,1H3 |
| InChIKey | SOGDYQPFDCSIEG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |