About 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide
4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide (PubChem CID 1079375) has the molecular formula C20H25N3O3
and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide.
Molecular Properties
| Compound Name | 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide |
| PubChem CID | 1079375 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-6-5-13-20(3,4)18(14)12-7-15(2)21-22-19(24)16-8-10-17(11-9-16)23(25)26/h7-12H,5-6,13H2,1-4H3,(H,22,24) |
| InChIKey | XAOSVLULPNMZLN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide?
The IUPAC name of 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide (CID 1079375) is 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide.
What is the SMILES notation for 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide?
The canonical SMILES for 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide is CC(C=CC1=C(C)CCCC1(C)C)=NNC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide?
The InChIKey is XAOSVLULPNMZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O3/c1-14-6-5-13-20(3,4)18(14)12-7-15(2)21-22-19(24)16-8-10-17(11-9-16)23(25)26/h7-12H,5-6,13H2,1-4H3,(H,22,24).
What are the key properties of 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide?
4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide has a molecular weight of 355.44 g/mol, XLogP of 4.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]benzamide is sourced from PubChem (CID 1079375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).