5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid

C15H29NO4 — CID 107938043

IUPAC5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid
SMILESCCCOCC(=O)NCCC(CCC(=O)O)C(C)(C)C
InChIInChI=1S/C15H29NO4/c1-5-10-20-11-13(17)16-9-8-12(15(2,3)4)6-7-14(18)19/h12H,5-11H2,1-4H3,(H,16,17)(H,18,19)
InChIKeyLXOJLDIOFFRVNX-UHFFFAOYSA-N
MW287.40 g/mol
LogP2.45
Rot. Bonds10

About 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid

5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid (PubChem CID 107938043) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid.

Molecular Properties

Compound Name5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid
PubChem CID107938043
Molecular FormulaC15H29NO4
Molecular Weight287.40 g/mol
Exact Mass287.21
IUPAC Name5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid
SMILESCCCOCC(=O)NCCC(CCC(=O)O)C(C)(C)C
InChIInChI=1S/C15H29NO4/c1-5-10-20-11-13(17)16-9-8-12(15(2,3)4)6-7-14(18)19/h12H,5-11H2,1-4H3,(H,16,17)(H,18,19)
InChIKeyLXOJLDIOFFRVNX-UHFFFAOYSA-N
XLogP2.45
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.40
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid?
The IUPAC name of 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid (CID 107938043) is 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid.
What is the SMILES notation for 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid?
The canonical SMILES for 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid is CCCOCC(=O)NCCC(CCC(=O)O)C(C)(C)C.
What is the InChIKey of 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid?
The InChIKey is LXOJLDIOFFRVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO4/c1-5-10-20-11-13(17)16-9-8-12(15(2,3)4)6-7-14(18)19/h12H,5-11H2,1-4H3,(H,16,17)(H,18,19).
What are the key properties of 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid?
5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid has a molecular weight of 287.40 g/mol, XLogP of 2.45, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid is sourced from PubChem (CID 107938043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).