C15H29NO4 — CID 107938043
5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid (PubChem CID 107938043) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid.
| Compound Name | 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 107938043 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 5,5-dimethyl-4-[2-[(2-propoxyacetyl)amino]ethyl]hexanoic acid |
| SMILES | CCCOCC(=O)NCCC(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H29NO4/c1-5-10-20-11-13(17)16-9-8-12(15(2,3)4)6-7-14(18)19/h12H,5-11H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | LXOJLDIOFFRVNX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|