C12H15Br2N — CID 107938538
2-(2,4-dibromophenyl)azepane (PubChem CID 107938538) has the molecular formula C12H15Br2N and a molecular weight of 333.07 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)azepane.
| Compound Name | 2-(2,4-dibromophenyl)azepane |
|---|---|
| PubChem CID | 107938538 |
| Molecular Formula | C12H15Br2N |
| Molecular Weight | 333.07 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 2-(2,4-dibromophenyl)azepane |
| SMILES | Brc1ccc(C2CCCCCN2)c(Br)c1 |
| InChI | InChI=1S/C12H15Br2N/c13-9-5-6-10(11(14)8-9)12-4-2-1-3-7-15-12/h5-6,8,12,15H,1-4,7H2 |
| InChIKey | WTNTYKWQQSYFKC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.07 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |