C18H34N8 — CID 10793911
2-[[3-[[[amino-[2-(dimethylamino)ethylamino]methylidene]amino]methyl]phenyl]methyl]-1-[2-(dimethylamino)ethyl]guanidine (PubChem CID 10793911) has the molecular formula C18H34N8 and a molecular weight of 362.53 g/mol. Its IUPAC name is 2-[[3-[[[amino-[2-(dimethylamino)ethylamino]methylidene]amino]methyl]phenyl]methyl]-1-[2-(dimethylamino)ethyl]guanidine.
| Compound Name | 2-[[3-[[[amino-[2-(dimethylamino)ethylamino]methylidene]amino]methyl]phenyl]methyl]-1-[2-(dimethylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 10793911 |
| Molecular Formula | C18H34N8 |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 2-[[3-[[[amino-[2-(dimethylamino)ethylamino]methylidene]amino]methyl]phenyl]methyl]-1-[2-(dimethylamino)ethyl]guanidine |
| SMILES | CN(C)CCN/C(N)=N/Cc1cccc(C/N=C(\N)NCCN(C)C)c1 |
| InChI | InChI=1S/C18H34N8/c1-25(2)10-8-21-17(19)23-13-15-6-5-7-16(12-15)14-24-18(20)22-9-11-26(3)4/h5-7,12H,8-11,13-14H2,1-4H3,(H3,19,21,23)(H3,20,22,24) |
| InChIKey | IMNDMSIZMOUTIW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|