C13H10BrClN2O2S — CID 107939232
methyl 2-(3-bromo-5-chlorophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carboxylate (PubChem CID 107939232) has the molecular formula C13H10BrClN2O2S and a molecular weight of 373.66 g/mol. Its IUPAC name is methyl 2-(3-bromo-5-chlorophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 2-(3-bromo-5-chlorophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 107939232 |
| Molecular Formula | C13H10BrClN2O2S |
| Molecular Weight | 373.66 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | methyl 2-(3-bromo-5-chlorophenyl)-6-methyl-4-sulfanylidene-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(-c2cc(Cl)cc(Br)c2)nc1=S |
| InChI | InChI=1S/C13H10BrClN2O2S/c1-6-10(13(18)19-2)12(20)17-11(16-6)7-3-8(14)5-9(15)4-7/h3-5H,1-2H3,(H,16,17,20) |
| InChIKey | FEMJMPNJTPFPDU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|