C12H16BrClN2O2 — CID 107940200
3-bromo-5-chloro-N-[2-(2-hydroxypropylamino)ethyl]benzamide (PubChem CID 107940200) has the molecular formula C12H16BrClN2O2 and a molecular weight of 335.63 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[2-(2-hydroxypropylamino)ethyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[2-(2-hydroxypropylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 107940200 |
| Molecular Formula | C12H16BrClN2O2 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 3-bromo-5-chloro-N-[2-(2-hydroxypropylamino)ethyl]benzamide |
| SMILES | CC(O)CNCCNC(=O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C12H16BrClN2O2/c1-8(17)7-15-2-3-16-12(18)9-4-10(13)6-11(14)5-9/h4-6,8,15,17H,2-3,7H2,1H3,(H,16,18) |
| InChIKey | AQTWXXMEHPPTDT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|