C6H11N3O2 — CID 107940711
5-(propoxymethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 107940711) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-(propoxymethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(propoxymethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 107940711 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 5-(propoxymethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CCCOCc1nc(N)no1 |
| InChI | InChI=1S/C6H11N3O2/c1-2-3-10-4-5-8-6(7)9-11-5/h2-4H2,1H3,(H2,7,9) |
| InChIKey | TWEBLZQWHSJOMJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|