C6H9IN2O2 — CID 107940720
3-iodo-5-(propoxymethyl)-1,2,4-oxadiazole (PubChem CID 107940720) has the molecular formula C6H9IN2O2 and a molecular weight of 268.05 g/mol. Its IUPAC name is 3-iodo-5-(propoxymethyl)-1,2,4-oxadiazole.
| Compound Name | 3-iodo-5-(propoxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107940720 |
| Molecular Formula | C6H9IN2O2 |
| Molecular Weight | 268.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 3-iodo-5-(propoxymethyl)-1,2,4-oxadiazole |
| SMILES | CCCOCc1nc(I)no1 |
| InChI | InChI=1S/C6H9IN2O2/c1-2-3-10-4-5-8-6(7)9-11-5/h2-4H2,1H3 |
| InChIKey | NBRTZAUTSVRZSF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|