C15H9Br2N3 — CID 107941821
2-(2,4-dibromophenyl)-1-methylbenzimidazole-4-carbonitrile (PubChem CID 107941821) has the molecular formula C15H9Br2N3 and a molecular weight of 391.07 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-1-methylbenzimidazole-4-carbonitrile.
| Compound Name | 2-(2,4-dibromophenyl)-1-methylbenzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 107941821 |
| Molecular Formula | C15H9Br2N3 |
| Molecular Weight | 391.07 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 2-(2,4-dibromophenyl)-1-methylbenzimidazole-4-carbonitrile |
| SMILES | Cn1c(-c2ccc(Br)cc2Br)nc2c(C#N)cccc21 |
| InChI | InChI=1S/C15H9Br2N3/c1-20-13-4-2-3-9(8-18)14(13)19-15(20)11-6-5-10(16)7-12(11)17/h2-7H,1H3 |
| InChIKey | XOFQSYJBHQQVIO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.07 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |