C9H16F2O3 — CID 107942627
3-(2,2-difluoroethoxy)-2-propoxycyclobutan-1-ol (PubChem CID 107942627) has the molecular formula C9H16F2O3 and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2-propoxycyclobutan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-2-propoxycyclobutan-1-ol |
|---|---|
| PubChem CID | 107942627 |
| Molecular Formula | C9H16F2O3 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2-propoxycyclobutan-1-ol |
| SMILES | CCCOC1C(O)CC1OCC(F)F |
| InChI | InChI=1S/C9H16F2O3/c1-2-3-13-9-6(12)4-7(9)14-5-8(10)11/h6-9,12H,2-5H2,1H3 |
| InChIKey | WFUYUVIVVROKPR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |