C13H17ClN2O4 — CID 107943636
3-(5-chloro-2-nitrophenoxy)-2-propoxycyclobutan-1-amine (PubChem CID 107943636) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is 3-(5-chloro-2-nitrophenoxy)-2-propoxycyclobutan-1-amine.
| Compound Name | 3-(5-chloro-2-nitrophenoxy)-2-propoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 107943636 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-(5-chloro-2-nitrophenoxy)-2-propoxycyclobutan-1-amine |
| SMILES | CCCOC1C(N)CC1Oc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17ClN2O4/c1-2-5-19-13-9(15)7-12(13)20-11-6-8(14)3-4-10(11)16(17)18/h3-4,6,9,12-13H,2,5,7,15H2,1H3 |
| InChIKey | HILDATSHZQBCJU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|