C41H66O6 — CID 10794379
methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-di(pentanoyloxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 10794379) has the molecular formula C41H66O6 and a molecular weight of 654.97 g/mol. Its IUPAC name is methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-di(pentanoyloxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-di(pentanoyloxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 10794379 |
| Molecular Formula | C41H66O6 |
| Molecular Weight | 654.97 g/mol |
| Exact Mass | 654.49 |
| IUPAC Name | methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-5,10-di(pentanoyloxy)-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CCCCC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@H]5CC(C)(C)CC[C@]5(C(=O)OC)[C@H](OC(=O)CCCC)C[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C41H66O6/c1-11-13-15-33(42)46-31-20-21-38(7)29(37(31,5)6)19-22-39(8)30(38)18-17-27-28-25-36(3,4)23-24-41(28,35(44)45-10)32(26-40(27,39)9)47-34(43)16-14-12-2/h17,28-32H,11-16,18-26H2,1-10H3/t28-,29+,30-,31+,32-,38+,39-,40-,41-/m1/s1 |
| InChIKey | QZTQJHUFDOIHBB-CAHMMQMASA-N |
| XLogP | 9.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.97 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|