C46H48N4 — CID 10794402
1,1,3,3-tetramethyl-2-[2,2,4,4-tetramethyl-3-(1,1,3,3-tetramethylcyclopenta[f][1,10]phenanthrolin-2-ylidene)cyclobutylidene]cyclopenta[f][1,10]phenanthroline (PubChem CID 10794402) has the molecular formula C46H48N4 and a molecular weight of 656.92 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[2,2,4,4-tetramethyl-3-(1,1,3,3-tetramethylcyclopenta[f][1,10]phenanthrolin-2-ylidene)cyclobutylidene]cyclopenta[f][1,10]phenanthroline.
| Compound Name | 1,1,3,3-tetramethyl-2-[2,2,4,4-tetramethyl-3-(1,1,3,3-tetramethylcyclopenta[f][1,10]phenanthrolin-2-ylidene)cyclobutylidene]cyclopenta[f][1,10]phenanthroline |
|---|---|
| PubChem CID | 10794402 |
| Molecular Formula | C46H48N4 |
| Molecular Weight | 656.92 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[2,2,4,4-tetramethyl-3-(1,1,3,3-tetramethylcyclopenta[f][1,10]phenanthrolin-2-ylidene)cyclobutylidene]cyclopenta[f][1,10]phenanthroline |
| SMILES | CC1(C)C(=C2C(C)(C)c3c(c4cccnc4c4ncccc34)C2(C)C)C(C)(C)C1=C1C(C)(C)c2c(c3cccnc3c3ncccc23)C1(C)C |
| InChI | InChI=1S/C46H48N4/c1-41(2)29-25-17-13-21-47-33(25)34-26(18-14-22-48-34)30(29)42(3,4)37(41)39-45(9,10)40(46(39,11)12)38-43(5,6)31-27-19-15-23-49-35(27)36-28(20-16-24-50-36)32(31)44(38,7)8/h13-24H,1-12H3 |
| InChIKey | CTWXFPXHNBXIPV-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.92 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|