C13H16Br2O — CID 107944387
1-(2,4-dibromophenyl)-3-methylhexan-1-one (PubChem CID 107944387) has the molecular formula C13H16Br2O and a molecular weight of 348.08 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-3-methylhexan-1-one.
| Compound Name | 1-(2,4-dibromophenyl)-3-methylhexan-1-one |
|---|---|
| PubChem CID | 107944387 |
| Molecular Formula | C13H16Br2O |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 1-(2,4-dibromophenyl)-3-methylhexan-1-one |
| SMILES | CCCC(C)CC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H16Br2O/c1-3-4-9(2)7-13(16)11-6-5-10(14)8-12(11)15/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | YRFFDMISWKXYSF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |