C14H11BrClF2N — CID 107945220
1-(3-bromo-5-chlorophenyl)-2-(2,5-difluorophenyl)ethanamine (PubChem CID 107945220) has the molecular formula C14H11BrClF2N and a molecular weight of 346.60 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-2-(2,5-difluorophenyl)ethanamine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-2-(2,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107945220 |
| Molecular Formula | C14H11BrClF2N |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-2-(2,5-difluorophenyl)ethanamine |
| SMILES | NC(Cc1cc(F)ccc1F)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C14H11BrClF2N/c15-10-3-9(4-11(16)7-10)14(19)6-8-5-12(17)1-2-13(8)18/h1-5,7,14H,6,19H2 |
| InChIKey | HYNLCZYZUHZTMS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |