C15H19Br2N3 — CID 107945297
1-(2,4-dibromophenyl)-N-ethyl-2-(1-ethylpyrazol-4-yl)ethanamine (PubChem CID 107945297) has the molecular formula C15H19Br2N3 and a molecular weight of 401.15 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-N-ethyl-2-(1-ethylpyrazol-4-yl)ethanamine.
| Compound Name | 1-(2,4-dibromophenyl)-N-ethyl-2-(1-ethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107945297 |
| Molecular Formula | C15H19Br2N3 |
| Molecular Weight | 401.15 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 1-(2,4-dibromophenyl)-N-ethyl-2-(1-ethylpyrazol-4-yl)ethanamine |
| SMILES | CCNC(Cc1cnn(CC)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H19Br2N3/c1-3-18-15(7-11-9-19-20(4-2)10-11)13-6-5-12(16)8-14(13)17/h5-6,8-10,15,18H,3-4,7H2,1-2H3 |
| InChIKey | RGYSVICIMNJINQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |