C33H28N2O14 — CID 10794620
methyl 5-[2-acetyloxy-3-(2-methoxycarbonyl-4-oxochromen-5-yl)oxypropoxy]-4-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate (PubChem CID 10794620) has the molecular formula C33H28N2O14 and a molecular weight of 676.59 g/mol. Its IUPAC name is methyl 5-[2-acetyloxy-3-(2-methoxycarbonyl-4-oxochromen-5-yl)oxypropoxy]-4-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate.
| Compound Name | methyl 5-[2-acetyloxy-3-(2-methoxycarbonyl-4-oxochromen-5-yl)oxypropoxy]-4-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate |
|---|---|
| PubChem CID | 10794620 |
| Molecular Formula | C33H28N2O14 |
| Molecular Weight | 676.59 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | methyl 5-[2-acetyloxy-3-(2-methoxycarbonyl-4-oxochromen-5-yl)oxypropoxy]-4-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)chromene-2-carboxylate |
| SMILES | COC(=O)C1=CC(=C2C(=O)N(C)C(=O)N(C)C2=O)c2c(OCC(COc3cccc4oc(C(=O)OC)cc(=O)c34)OC(C)=O)cccc2O1 |
| InChI | InChI=1S/C33H28N2O14/c1-16(36)47-17(15-46-21-9-7-11-23-28(21)19(37)13-25(49-23)32(41)44-5)14-45-20-8-6-10-22-26(20)18(12-24(48-22)31(40)43-4)27-29(38)34(2)33(42)35(3)30(27)39/h6-13,17H,14-15H2,1-5H3 |
| InChIKey | XNFGVJYFVAZVJA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 194.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|