C14H11Br2ClFN — CID 107947077
2-(5-chloro-2-fluorophenyl)-1-(2,4-dibromophenyl)ethanamine (PubChem CID 107947077) has the molecular formula C14H11Br2ClFN and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 107947077 |
| Molecular Formula | C14H11Br2ClFN |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 404.89 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-1-(2,4-dibromophenyl)ethanamine |
| SMILES | NC(Cc1cc(Cl)ccc1F)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2ClFN/c15-9-1-3-11(12(16)7-9)14(19)6-8-5-10(17)2-4-13(8)18/h1-5,7,14H,6,19H2 |
| InChIKey | GWQCOJCJAHWCQU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |