C15H14Br2O2 — CID 107947466
(2,4-dibromophenyl)-(2-ethoxyphenyl)methanol (PubChem CID 107947466) has the molecular formula C15H14Br2O2 and a molecular weight of 386.08 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(2-ethoxyphenyl)methanol.
| Compound Name | (2,4-dibromophenyl)-(2-ethoxyphenyl)methanol |
|---|---|
| PubChem CID | 107947466 |
| Molecular Formula | C15H14Br2O2 |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | (2,4-dibromophenyl)-(2-ethoxyphenyl)methanol |
| SMILES | CCOc1ccccc1C(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H14Br2O2/c1-2-19-14-6-4-3-5-12(14)15(18)11-8-7-10(16)9-13(11)17/h3-9,15,18H,2H2,1H3 |
| InChIKey | CZJMSBGTBOMXCG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |