(2,4-dibromophenyl)-(3-ethylphenyl)methanol

C15H14Br2O — CID 107947696

IUPAC(2,4-dibromophenyl)-(3-ethylphenyl)methanol
SMILESCCc1cccc(C(O)c2ccc(Br)cc2Br)c1
InChIInChI=1S/C15H14Br2O/c1-2-10-4-3-5-11(8-10)15(18)13-7-6-12(16)9-14(13)17/h3-9,15,18H,2H2,1H3
InChIKeySEZVARVTFGGUKT-UHFFFAOYSA-N
MW370.08 g/mol
LogP4.86
Rot. Bonds3

About (2,4-dibromophenyl)-(3-ethylphenyl)methanol

(2,4-dibromophenyl)-(3-ethylphenyl)methanol (PubChem CID 107947696) has the molecular formula C15H14Br2O and a molecular weight of 370.08 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(3-ethylphenyl)methanol.

Molecular Properties

Compound Name(2,4-dibromophenyl)-(3-ethylphenyl)methanol
PubChem CID107947696
Molecular FormulaC15H14Br2O
Molecular Weight370.08 g/mol
Exact Mass367.94
IUPAC Name(2,4-dibromophenyl)-(3-ethylphenyl)methanol
SMILESCCc1cccc(C(O)c2ccc(Br)cc2Br)c1
InChIInChI=1S/C15H14Br2O/c1-2-10-4-3-5-11(8-10)15(18)13-7-6-12(16)9-14(13)17/h3-9,15,18H,2H2,1H3
InChIKeySEZVARVTFGGUKT-UHFFFAOYSA-N
XLogP4.86
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500370.08
LogP ≤ 54.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2,4-dibromophenyl)-(3-ethylphenyl)methanol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2,4-dibromophenyl)-(3-ethylphenyl)methanamine
CID 107946458
(3,5-dibromophenyl)-(3-ethylphenyl)methanol
CID 107978572
(2,5-dibromothiophen-3-yl)-(3-ethylphenyl)methanol
CID 107969813
(4-bromo-2-fluorophenyl)-(3-propylphenyl)methanol
CID 116542467
(2,4-dibromophenyl)-(3-propan-2-yloxyphenyl)methanol
CID 107947698
(3-ethylphenyl)-(2-iodophenyl)methanol
CID 115823914
(5-bromo-2-fluorophenyl)-(3-propylphenyl)methanol
CID 116542464
(2,4-dibromophenyl)-[4-(2-methylpropyl)phenyl]methanol
CID 107955306
(4-bromo-5-methylthiophen-2-yl)-(3-ethylphenyl)methanol
CID 102829560
(2,4-dibromophenyl)-(3,5-dimethylphenyl)methanol
CID 107947280
(3-bromophenyl)-(2-ethylphenyl)methanol
CID 91657859
[(2,5-dibromophenyl)-(3-ethylphenyl)methyl]hydrazine
CID 105326320

Frequently Asked Questions

What is the IUPAC name of (2,4-dibromophenyl)-(3-ethylphenyl)methanol?
The IUPAC name of (2,4-dibromophenyl)-(3-ethylphenyl)methanol (CID 107947696) is (2,4-dibromophenyl)-(3-ethylphenyl)methanol.
What is the SMILES notation for (2,4-dibromophenyl)-(3-ethylphenyl)methanol?
The canonical SMILES for (2,4-dibromophenyl)-(3-ethylphenyl)methanol is CCc1cccc(C(O)c2ccc(Br)cc2Br)c1.
What is the InChIKey of (2,4-dibromophenyl)-(3-ethylphenyl)methanol?
The InChIKey is SEZVARVTFGGUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Br2O/c1-2-10-4-3-5-11(8-10)15(18)13-7-6-12(16)9-14(13)17/h3-9,15,18H,2H2,1H3.
What are the key properties of (2,4-dibromophenyl)-(3-ethylphenyl)methanol?
(2,4-dibromophenyl)-(3-ethylphenyl)methanol has a molecular weight of 370.08 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dibromophenyl)-(3-ethylphenyl)methanol is sourced from PubChem (CID 107947696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).