C43H54N2O7 — CID 10794918
(4R,5S,6S,7R)-1,3-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-4,7-bis(2-phenylethyl)-1,3-diazepan-2-one (PubChem CID 10794918) has the molecular formula C43H54N2O7 and a molecular weight of 710.91 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1,3-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-4,7-bis(2-phenylethyl)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1,3-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-4,7-bis(2-phenylethyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 10794918 |
| Molecular Formula | C43H54N2O7 |
| Molecular Weight | 710.91 g/mol |
| Exact Mass | 710.39 |
| IUPAC Name | (4R,5S,6S,7R)-1,3-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-4,7-bis(2-phenylethyl)-1,3-diazepan-2-one |
| SMILES | COCCOCO[C@@H]1[C@@H](OCOCCOC)[C@@H](CCc2ccccc2)N(Cc2ccccc2)C(=O)N(Cc2ccccc2)[C@@H]1CCc1ccccc1 |
| InChI | InChI=1S/C43H54N2O7/c1-47-27-29-49-33-51-41-39(25-23-35-15-7-3-8-16-35)44(31-37-19-11-5-12-20-37)43(46)45(32-38-21-13-6-14-22-38)40(26-24-36-17-9-4-10-18-36)42(41)52-34-50-30-28-48-2/h3-22,39-42H,23-34H2,1-2H3/t39-,40-,41+,42+/m1/s1 |
| InChIKey | FMJLJVMOGDHFMU-GLGKVNTQSA-N |
| XLogP | 7.14 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.91 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|