C16H11Br2NO — CID 107949694
(2,4-dibromophenyl)-(2-methyl-1H-indol-3-yl)methanone (PubChem CID 107949694) has the molecular formula C16H11Br2NO and a molecular weight of 393.08 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(2-methyl-1H-indol-3-yl)methanone.
| Compound Name | (2,4-dibromophenyl)-(2-methyl-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 107949694 |
| Molecular Formula | C16H11Br2NO |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | (2,4-dibromophenyl)-(2-methyl-1H-indol-3-yl)methanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H11Br2NO/c1-9-15(12-4-2-3-5-14(12)19-9)16(20)11-7-6-10(17)8-13(11)18/h2-8,19H,1H3 |
| InChIKey | JSZFZPXOINAJKM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |