C17H15Br2NS — CID 107950423
N-[1-benzothiophen-3-yl-(2,4-dibromophenyl)methyl]ethanamine (PubChem CID 107950423) has the molecular formula C17H15Br2NS and a molecular weight of 425.19 g/mol. Its IUPAC name is N-[1-benzothiophen-3-yl-(2,4-dibromophenyl)methyl]ethanamine.
| Compound Name | N-[1-benzothiophen-3-yl-(2,4-dibromophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107950423 |
| Molecular Formula | C17H15Br2NS |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 422.93 |
| IUPAC Name | N-[1-benzothiophen-3-yl-(2,4-dibromophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)cc1Br)c1csc2ccccc12 |
| InChI | InChI=1S/C17H15Br2NS/c1-2-20-17(13-8-7-11(18)9-15(13)19)14-10-21-16-6-4-3-5-12(14)16/h3-10,17,20H,2H2,1H3 |
| InChIKey | LMHVWUPSBMBHLC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |