C39H49N4O2+ — CID 10795044
N'-[1-[(3,5-dimethoxyphenyl)methyl]-2-methylquinolin-1-ium-4-yl]-N-(2-methylquinolin-4-yl)decane-1,10-diamine (PubChem CID 10795044) has the molecular formula C39H49N4O2+ and a molecular weight of 605.85 g/mol. Its IUPAC name is N'-[1-[(3,5-dimethoxyphenyl)methyl]-2-methylquinolin-1-ium-4-yl]-N-(2-methylquinolin-4-yl)decane-1,10-diamine.
| Compound Name | N'-[1-[(3,5-dimethoxyphenyl)methyl]-2-methylquinolin-1-ium-4-yl]-N-(2-methylquinolin-4-yl)decane-1,10-diamine |
|---|---|
| PubChem CID | 10795044 |
| Molecular Formula | C39H49N4O2+ |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.39 |
| IUPAC Name | N'-[1-[(3,5-dimethoxyphenyl)methyl]-2-methylquinolin-1-ium-4-yl]-N-(2-methylquinolin-4-yl)decane-1,10-diamine |
| SMILES | COc1cc(C[n+]2c(C)cc(NCCCCCCCCCCNc3cc(C)nc4ccccc34)c3ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C39H48N4O2/c1-29-23-37(34-17-11-13-19-36(34)42-29)40-21-15-9-7-5-6-8-10-16-22-41-38-24-30(2)43(39-20-14-12-18-35(38)39)28-31-25-32(44-3)27-33(26-31)45-4/h11-14,17-20,23-27H,5-10,15-16,21-22,28H2,1-4H3,(H,40,42)/p+1 |
| InChIKey | GDERYWIOGUTQMC-UHFFFAOYSA-O |
| XLogP | 9.00 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|