C15H16BrFN2O — CID 107951120
3-bromo-N-(1-cyano-4-methylcyclohexyl)-2-fluorobenzamide (PubChem CID 107951120) has the molecular formula C15H16BrFN2O and a molecular weight of 339.21 g/mol. Its IUPAC name is 3-bromo-N-(1-cyano-4-methylcyclohexyl)-2-fluorobenzamide.
| Compound Name | 3-bromo-N-(1-cyano-4-methylcyclohexyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 107951120 |
| Molecular Formula | C15H16BrFN2O |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-bromo-N-(1-cyano-4-methylcyclohexyl)-2-fluorobenzamide |
| SMILES | CC1CCC(C#N)(NC(=O)c2cccc(Br)c2F)CC1 |
| InChI | InChI=1S/C15H16BrFN2O/c1-10-5-7-15(9-18,8-6-10)19-14(20)11-3-2-4-12(16)13(11)17/h2-4,10H,5-8H2,1H3,(H,19,20) |
| InChIKey | FXQVSQNRLQMNJL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |