C15H11BrCl3NO — CID 107951762
3-bromo-5-chloro-N-[1-(3,4-dichlorophenyl)ethyl]benzamide (PubChem CID 107951762) has the molecular formula C15H11BrCl3NO and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[1-(3,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 3-bromo-5-chloro-N-[1-(3,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 107951762 |
| Molecular Formula | C15H11BrCl3NO |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | 3-bromo-5-chloro-N-[1-(3,4-dichlorophenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(Cl)cc(Br)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11BrCl3NO/c1-8(9-2-3-13(18)14(19)6-9)20-15(21)10-4-11(16)7-12(17)5-10/h2-8H,1H3,(H,20,21) |
| InChIKey | RPXQFEMWCYGXON-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |