C16H16Br2FNO — CID 107952546
1-(3-bromo-2-fluorophenyl)-2-(3-bromo-4-methoxyphenyl)-N-methylethanamine (PubChem CID 107952546) has the molecular formula C16H16Br2FNO and a molecular weight of 417.12 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)-2-(3-bromo-4-methoxyphenyl)-N-methylethanamine.
| Compound Name | 1-(3-bromo-2-fluorophenyl)-2-(3-bromo-4-methoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 107952546 |
| Molecular Formula | C16H16Br2FNO |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)-2-(3-bromo-4-methoxyphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(OC)c(Br)c1)c1cccc(Br)c1F |
| InChI | InChI=1S/C16H16Br2FNO/c1-20-14(11-4-3-5-12(17)16(11)19)9-10-6-7-15(21-2)13(18)8-10/h3-8,14,20H,9H2,1-2H3 |
| InChIKey | HHZOYMJZLPRYOT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |