C9H4Br2ClN — CID 107954598
(E)-3-chloro-3-(2,4-dibromophenyl)prop-2-enenitrile (PubChem CID 107954598) has the molecular formula C9H4Br2ClN and a molecular weight of 321.40 g/mol. Its IUPAC name is (E)-3-chloro-3-(2,4-dibromophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-chloro-3-(2,4-dibromophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 107954598 |
| Molecular Formula | C9H4Br2ClN |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 318.84 |
| IUPAC Name | (E)-3-chloro-3-(2,4-dibromophenyl)prop-2-enenitrile |
| SMILES | N#C/C=C(/Cl)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H4Br2ClN/c10-6-1-2-7(8(11)5-6)9(12)3-4-13/h1-3,5H/b9-3+ |
| InChIKey | NQDQJBQGJZKTHA-YCRREMRBSA-N |
| XLogP | 4.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|