C14H16BrFN2O — CID 107956331
1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(3-bromo-2-fluorophenyl)methanone (PubChem CID 107956331) has the molecular formula C14H16BrFN2O and a molecular weight of 327.20 g/mol. Its IUPAC name is 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(3-bromo-2-fluorophenyl)methanone.
| Compound Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(3-bromo-2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 107956331 |
| Molecular Formula | C14H16BrFN2O |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl-(3-bromo-2-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(Br)c1F)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C14H16BrFN2O/c15-11-5-1-4-10(13(11)16)14(19)18-7-9-3-2-6-17-12(9)8-18/h1,4-5,9,12,17H,2-3,6-8H2 |
| InChIKey | AUQYADLFSARIES-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |