C14H10Br3Cl — CID 107957989
2,4-dibromo-1-[2-(3-bromophenyl)-1-chloroethyl]benzene (PubChem CID 107957989) has the molecular formula C14H10Br3Cl and a molecular weight of 453.40 g/mol. Its IUPAC name is 2,4-dibromo-1-[2-(3-bromophenyl)-1-chloroethyl]benzene.
| Compound Name | 2,4-dibromo-1-[2-(3-bromophenyl)-1-chloroethyl]benzene |
|---|---|
| PubChem CID | 107957989 |
| Molecular Formula | C14H10Br3Cl |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 449.80 |
| IUPAC Name | 2,4-dibromo-1-[2-(3-bromophenyl)-1-chloroethyl]benzene |
| SMILES | ClC(Cc1cccc(Br)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H10Br3Cl/c15-10-3-1-2-9(6-10)7-14(18)12-5-4-11(16)8-13(12)17/h1-6,8,14H,7H2 |
| InChIKey | ZTRKWPPKXGJHRG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|