About 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one
6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 107960022) has the molecular formula C15H11Cl2NO2S
and a molecular weight of 340.23 g/mol. Its IUPAC name is 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 107960022 |
| Molecular Formula | C15H11Cl2NO2S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C(=O)c3cc(Cl)sc3Cl)ccc21 |
| InChI | InChI=1S/C15H11Cl2NO2S/c1-18-11-4-2-9(6-8(11)3-5-13(18)19)14(20)10-7-12(16)21-15(10)17/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | BCKOFVPJYOINRO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one (CID 107960022) is 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one is CN1C(=O)CCc2cc(C(=O)c3cc(Cl)sc3Cl)ccc21.
What is the InChIKey of 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one?
The InChIKey is BCKOFVPJYOINRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO2S/c1-18-11-4-2-9(6-8(11)3-5-13(18)19)14(20)10-7-12(16)21-15(10)17/h2,4,6-7H,3,5H2,1H3.
What are the key properties of 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one?
6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one has a molecular weight of 340.23 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dichlorothiophene-3-carbonyl)-1-methyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 107960022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).