C13H6Cl2FNOS — CID 107960033
(2,5-dichlorothiophen-3-yl)-(5-fluoro-1H-indol-3-yl)methanone (PubChem CID 107960033) has the molecular formula C13H6Cl2FNOS and a molecular weight of 314.17 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(5-fluoro-1H-indol-3-yl)methanone.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(5-fluoro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 107960033 |
| Molecular Formula | C13H6Cl2FNOS |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(5-fluoro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1cc(Cl)sc1Cl)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C13H6Cl2FNOS/c14-11-4-8(13(15)19-11)12(18)9-5-17-10-2-1-6(16)3-7(9)10/h1-5,17H |
| InChIKey | KEDQXJWMXLZRAI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |