C60H46N2+2 — CID 10796047
4-(2,4,6-triphenylphenyl)-1-[2-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]ethyl]pyridin-1-ium (PubChem CID 10796047) has the molecular formula C60H46N2+2 and a molecular weight of 795.04 g/mol. Its IUPAC name is 4-(2,4,6-triphenylphenyl)-1-[2-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]ethyl]pyridin-1-ium.
| Compound Name | 4-(2,4,6-triphenylphenyl)-1-[2-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 10796047 |
| Molecular Formula | C60H46N2+2 |
| Molecular Weight | 795.04 g/mol |
| Exact Mass | 794.37 |
| IUPAC Name | 4-(2,4,6-triphenylphenyl)-1-[2-[4-(2,4,6-triphenylphenyl)pyridin-1-ium-1-yl]ethyl]pyridin-1-ium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)c(-c3cc[n+](CC[n+]4ccc(-c5c(-c6ccccc6)cc(-c6ccccc6)cc5-c5ccccc5)cc4)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C60H46N2/c1-7-19-45(20-8-1)53-41-55(47-23-11-3-12-24-47)59(56(42-53)48-25-13-4-14-26-48)51-31-35-61(36-32-51)39-40-62-37-33-52(34-38-62)60-57(49-27-15-5-16-28-49)43-54(46-21-9-2-10-22-46)44-58(60)50-29-17-6-18-30-50/h1-38,41-44H,39-40H2/q+2 |
| InChIKey | QWKMDWZPYTXWEL-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.04 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|