About 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol
2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol (PubChem CID 107961508) has the molecular formula C7H9Cl2NOS
and a molecular weight of 226.13 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol |
| PubChem CID | 107961508 |
| Molecular Formula | C7H9Cl2NOS |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol |
| SMILES | OCCNCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H9Cl2NOS/c8-6-3-5(7(9)12-6)4-10-1-2-11/h3,10-11H,1-2,4H2 |
| InChIKey | PODUCVTVTJQAKC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol?
The IUPAC name of 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol (CID 107961508) is 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol.
What is the SMILES notation for 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol?
The canonical SMILES for 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol is OCCNCc1cc(Cl)sc1Cl.
What is the InChIKey of 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol?
The InChIKey is PODUCVTVTJQAKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2NOS/c8-6-3-5(7(9)12-6)4-10-1-2-11/h3,10-11H,1-2,4H2.
What are the key properties of 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol?
2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol has a molecular weight of 226.13 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dichlorothiophen-3-yl)methylamino]ethanol is sourced from PubChem (CID 107961508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).