C14H18Cl2N2OS2 — CID 107961704
N-(1-carbamothioyl-4-ethylcyclohexyl)-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107961704) has the molecular formula C14H18Cl2N2OS2 and a molecular weight of 365.35 g/mol. Its IUPAC name is N-(1-carbamothioyl-4-ethylcyclohexyl)-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-(1-carbamothioyl-4-ethylcyclohexyl)-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107961704 |
| Molecular Formula | C14H18Cl2N2OS2 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-(1-carbamothioyl-4-ethylcyclohexyl)-2,5-dichlorothiophene-3-carboxamide |
| SMILES | CCC1CCC(NC(=O)c2cc(Cl)sc2Cl)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H18Cl2N2OS2/c1-2-8-3-5-14(6-4-8,13(17)20)18-12(19)9-7-10(15)21-11(9)16/h7-8H,2-6H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | GVKGCTBGBTYLCJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|