About (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile
(2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile (PubChem CID 107963195) has the molecular formula C10H8Br2ClNS
and a molecular weight of 369.51 g/mol. Its IUPAC name is (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile.
Molecular Properties
| Compound Name | (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile |
| PubChem CID | 107963195 |
| Molecular Formula | C10H8Br2ClNS |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 366.84 |
| IUPAC Name | (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile |
| SMILES | CCC/C(C#N)=C(/Cl)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H8Br2ClNS/c1-2-3-6(5-14)9(13)7-4-8(11)15-10(7)12/h4H,2-3H2,1H3/b9-6- |
| InChIKey | VMFQYVXNXHBNNT-TWGQIWQCSA-N |
| XLogP | 5.55 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile?
The IUPAC name of (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile (CID 107963195) is (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile.
What is the SMILES notation for (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile?
The canonical SMILES for (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile is CCC/C(C#N)=C(/Cl)c1cc(Br)sc1Br.
What is the InChIKey of (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile?
The InChIKey is VMFQYVXNXHBNNT-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H8Br2ClNS/c1-2-3-6(5-14)9(13)7-4-8(11)15-10(7)12/h4H,2-3H2,1H3/b9-6-.
What are the key properties of (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile?
(2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile has a molecular weight of 369.51 g/mol, XLogP of 5.55, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[chloro-(2,5-dibromothiophen-3-yl)methylidene]pentanenitrile is sourced from PubChem (CID 107963195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).