C12H7Cl2N3S2 — CID 107963257
3-(2,5-dichlorothiophen-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 107963257) has the molecular formula C12H7Cl2N3S2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 3-(2,5-dichlorothiophen-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2,5-dichlorothiophen-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 107963257 |
| Molecular Formula | C12H7Cl2N3S2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 3-(2,5-dichlorothiophen-3-yl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cc(Cl)sc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C12H7Cl2N3S2/c13-9-6-8(10(14)19-9)11-15-16-12(18)17(11)7-4-2-1-3-5-7/h1-6H,(H,16,18) |
| InChIKey | UHYGWIVZQARCMS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|