C7H5Br2N3S2 — CID 107963274
5-(2,5-dibromothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 107963274) has the molecular formula C7H5Br2N3S2 and a molecular weight of 355.08 g/mol. Its IUPAC name is 5-(2,5-dibromothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,5-dibromothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 107963274 |
| Molecular Formula | C7H5Br2N3S2 |
| Molecular Weight | 355.08 g/mol |
| Exact Mass | 352.83 |
| IUPAC Name | 5-(2,5-dibromothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | Cn1[nH]c(-c2cc(Br)sc2Br)nc1=S |
| InChI | InChI=1S/C7H5Br2N3S2/c1-12-7(13)10-6(11-12)3-2-4(8)14-5(3)9/h2H,1H3,(H,10,11,13) |
| InChIKey | SKKYPIAWGBFMNE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.08 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|