C11H7Br2N3OS2 — CID 107963974
N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2,5-dibromothiophene-3-carboxamide (PubChem CID 107963974) has the molecular formula C11H7Br2N3OS2 and a molecular weight of 421.14 g/mol. Its IUPAC name is N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2,5-dibromothiophene-3-carboxamide.
| Compound Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2,5-dibromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107963974 |
| Molecular Formula | C11H7Br2N3OS2 |
| Molecular Weight | 421.14 g/mol |
| Exact Mass | 418.84 |
| IUPAC Name | N-[5-(3-aminoprop-1-ynyl)-1,3-thiazol-2-yl]-2,5-dibromothiophene-3-carboxamide |
| SMILES | NCC#Cc1cnc(NC(=O)c2cc(Br)sc2Br)s1 |
| InChI | InChI=1S/C11H7Br2N3OS2/c12-8-4-7(9(13)19-8)10(17)16-11-15-5-6(18-11)2-1-3-14/h4-5H,3,14H2,(H,15,16,17) |
| InChIKey | PSVPABVKGMKPIX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|