C17H20Cl2OS — CID 107964351
(2,5-dichlorothiophen-3-yl)-(2,4,6-triethylphenyl)methanol (PubChem CID 107964351) has the molecular formula C17H20Cl2OS and a molecular weight of 343.32 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(2,4,6-triethylphenyl)methanol.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(2,4,6-triethylphenyl)methanol |
|---|---|
| PubChem CID | 107964351 |
| Molecular Formula | C17H20Cl2OS |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(2,4,6-triethylphenyl)methanol |
| SMILES | CCc1cc(CC)c(C(O)c2cc(Cl)sc2Cl)c(CC)c1 |
| InChI | InChI=1S/C17H20Cl2OS/c1-4-10-7-11(5-2)15(12(6-3)8-10)16(20)13-9-14(18)21-17(13)19/h7-9,16,20H,4-6H2,1-3H3 |
| InChIKey | SOPGHJNUHZFKGY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |