C14H11Br3N2OS — CID 107964768
5-[bromo-(2,5-dibromothiophen-3-yl)methyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 107964768) has the molecular formula C14H11Br3N2OS and a molecular weight of 495.03 g/mol. Its IUPAC name is 5-[bromo-(2,5-dibromothiophen-3-yl)methyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[bromo-(2,5-dibromothiophen-3-yl)methyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 107964768 |
| Molecular Formula | C14H11Br3N2OS |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 491.81 |
| IUPAC Name | 5-[bromo-(2,5-dibromothiophen-3-yl)methyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(C(Br)c3cc(Br)sc3Br)ccc21 |
| InChI | InChI=1S/C14H11Br3N2OS/c1-18-9-4-3-7(5-10(9)19(2)14(18)20)12(16)8-6-11(15)21-13(8)17/h3-6,12H,1-2H3 |
| InChIKey | PHKKPPNBISLVPS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|