C9H7Br3N2S2 — CID 107966909
2-(1-bromopropyl)-5-(2,5-dibromothiophen-3-yl)-1,3,4-thiadiazole (PubChem CID 107966909) has the molecular formula C9H7Br3N2S2 and a molecular weight of 447.02 g/mol. Its IUPAC name is 2-(1-bromopropyl)-5-(2,5-dibromothiophen-3-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-bromopropyl)-5-(2,5-dibromothiophen-3-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 107966909 |
| Molecular Formula | C9H7Br3N2S2 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 443.76 |
| IUPAC Name | 2-(1-bromopropyl)-5-(2,5-dibromothiophen-3-yl)-1,3,4-thiadiazole |
| SMILES | CCC(Br)c1nnc(-c2cc(Br)sc2Br)s1 |
| InChI | InChI=1S/C9H7Br3N2S2/c1-2-5(10)9-14-13-8(16-9)4-3-6(11)15-7(4)12/h3,5H,2H2,1H3 |
| InChIKey | ATOIWUFJAPGCIL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|